About 3-bromopropan-1-ol;triphenylphosphane
3-bromopropan-1-ol;triphenylphosphane (PubChem CID 87481966) has the molecular formula C21H22BrOP
and a molecular weight of 401.28 g/mol. Its IUPAC name is 3-bromopropan-1-ol;triphenylphosphane.
Molecular Properties
| Compound Name | 3-bromopropan-1-ol;triphenylphosphane |
| PubChem CID | 87481966 |
| Molecular Formula | C21H22BrOP |
| Molecular Weight | 401.28 g/mol |
| Exact Mass | 400.06 |
| IUPAC Name | 3-bromopropan-1-ol;triphenylphosphane |
| SMILES | OCCCBr.c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.C3H7BrO/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;4-2-1-3-5/h1-15H;5H,1-3H2 |
| InChIKey | KLZOEENJUPMZBO-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.28 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-bromopropan-1-ol;triphenylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromopropan-1-ol;triphenylphosphane?
The IUPAC name of 3-bromopropan-1-ol;triphenylphosphane (CID 87481966) is 3-bromopropan-1-ol;triphenylphosphane.
What is the SMILES notation for 3-bromopropan-1-ol;triphenylphosphane?
The canonical SMILES for 3-bromopropan-1-ol;triphenylphosphane is OCCCBr.c1ccc(P(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of 3-bromopropan-1-ol;triphenylphosphane?
The InChIKey is KLZOEENJUPMZBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15P.C3H7BrO/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;4-2-1-3-5/h1-15H;5H,1-3H2.
What are the key properties of 3-bromopropan-1-ol;triphenylphosphane?
3-bromopropan-1-ol;triphenylphosphane has a molecular weight of 401.28 g/mol, XLogP of 4.21, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromopropan-1-ol;triphenylphosphane is sourced from PubChem (CID 87481966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).