C17H22N2O8P2S2 — CID 159973391
1-[[methoxy(methyl)phosphoryl]methylsulfanyl]-4-nitrobenzene;methyl-[(4-nitrophenyl)sulfanylmethyl]phosphinic acid (PubChem CID 159973391) has the molecular formula C17H22N2O8P2S2 and a molecular weight of 508.45 g/mol. Its IUPAC name is 1-[[methoxy(methyl)phosphoryl]methylsulfanyl]-4-nitrobenzene;methyl-[(4-nitrophenyl)sulfanylmethyl]phosphinic acid.
| Compound Name | 1-[[methoxy(methyl)phosphoryl]methylsulfanyl]-4-nitrobenzene;methyl-[(4-nitrophenyl)sulfanylmethyl]phosphinic acid |
|---|---|
| PubChem CID | 159973391 |
| Molecular Formula | C17H22N2O8P2S2 |
| Molecular Weight | 508.45 g/mol |
| Exact Mass | 508.03 |
| IUPAC Name | 1-[[methoxy(methyl)phosphoryl]methylsulfanyl]-4-nitrobenzene;methyl-[(4-nitrophenyl)sulfanylmethyl]phosphinic acid |
| SMILES | COP(C)(=O)CSc1ccc([N+](=O)[O-])cc1.CP(=O)(O)CSc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C9H12NO4PS.C8H10NO4PS/c1-14-15(2,13)7-16-9-5-3-8(4-6-9)10(11)12;1-14(12,13)6-15-8-4-2-7(3-5-8)9(10)11/h3-6H,7H2,1-2H3;2-5H,6H2,1H3,(H,12,13) |
| InChIKey | OEVOQDKHMOUZTE-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 149.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.45 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|