C9H12NO6PS — CID 102409072
2-hydroxypropoxy-(4-nitrophenyl)sulfanylphosphinic acid (PubChem CID 102409072) has the molecular formula C9H12NO6PS and a molecular weight of 293.24 g/mol. Its IUPAC name is 2-hydroxypropoxy-(4-nitrophenyl)sulfanylphosphinic acid.
| Compound Name | 2-hydroxypropoxy-(4-nitrophenyl)sulfanylphosphinic acid |
|---|---|
| PubChem CID | 102409072 |
| Molecular Formula | C9H12NO6PS |
| Molecular Weight | 293.24 g/mol |
| Exact Mass | 293.01 |
| IUPAC Name | 2-hydroxypropoxy-(4-nitrophenyl)sulfanylphosphinic acid |
| SMILES | CC(O)COP(=O)(O)Sc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C9H12NO6PS/c1-7(11)6-16-17(14,15)18-9-4-2-8(3-5-9)10(12)13/h2-5,7,11H,6H2,1H3,(H,14,15) |
| InChIKey | YXHFWDKJJOGYKR-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 109.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.24 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|