C20H22ClN3O4 — CID 15997395
ethyl 1-[2-[3-(4-chlorophenyl)-6-oxopyridazin-1-yl]acetyl]piperidine-3-carboxylate (PubChem CID 15997395) has the molecular formula C20H22ClN3O4 and a molecular weight of 403.87 g/mol. Its IUPAC name is ethyl 1-[2-[3-(4-chlorophenyl)-6-oxopyridazin-1-yl]acetyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[2-[3-(4-chlorophenyl)-6-oxopyridazin-1-yl]acetyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 15997395 |
| Molecular Formula | C20H22ClN3O4 |
| Molecular Weight | 403.87 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | ethyl 1-[2-[3-(4-chlorophenyl)-6-oxopyridazin-1-yl]acetyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(C(=O)Cn2nc(-c3ccc(Cl)cc3)ccc2=O)C1 |
| InChI | InChI=1S/C20H22ClN3O4/c1-2-28-20(27)15-4-3-11-23(12-15)19(26)13-24-18(25)10-9-17(22-24)14-5-7-16(21)8-6-14/h5-10,15H,2-4,11-13H2,1H3 |
| InChIKey | CTWAFQLHDZLKJM-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.87 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |