C21H20N4O2S2 — CID 159977633
3-[[6-[(3-ethynylphenyl)methyl]pyrimidin-4-yl]amino]-N-methyl-4-methylsulfanylbenzenesulfonamide (PubChem CID 159977633) has the molecular formula C21H20N4O2S2 and a molecular weight of 424.55 g/mol. Its IUPAC name is 3-[[6-[(3-ethynylphenyl)methyl]pyrimidin-4-yl]amino]-N-methyl-4-methylsulfanylbenzenesulfonamide.
| Compound Name | 3-[[6-[(3-ethynylphenyl)methyl]pyrimidin-4-yl]amino]-N-methyl-4-methylsulfanylbenzenesulfonamide |
|---|---|
| PubChem CID | 159977633 |
| Molecular Formula | C21H20N4O2S2 |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | 3-[[6-[(3-ethynylphenyl)methyl]pyrimidin-4-yl]amino]-N-methyl-4-methylsulfanylbenzenesulfonamide |
| SMILES | C#Cc1cccc(Cc2cc(Nc3cc(S(=O)(=O)NC)ccc3SC)ncn2)c1 |
| InChI | InChI=1S/C21H20N4O2S2/c1-4-15-6-5-7-16(10-15)11-17-12-21(24-14-23-17)25-19-13-18(29(26,27)22-2)8-9-20(19)28-3/h1,5-10,12-14,22H,11H2,2-3H3,(H,23,24,25) |
| InChIKey | OFIYEERSRAJTAG-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|