C27H39N2O4+ — CID 159984361
tert-butyl (2S)-3-methyl-2-[2-[1-[[(2S)-1-phenylpropan-2-yl]carbamoyloxymethyl]pyridin-1-ium-3-yl]ethyl]butanoate (PubChem CID 159984361) has the molecular formula C27H39N2O4+ and a molecular weight of 455.62 g/mol. Its IUPAC name is tert-butyl (2S)-3-methyl-2-[2-[1-[[(2S)-1-phenylpropan-2-yl]carbamoyloxymethyl]pyridin-1-ium-3-yl]ethyl]butanoate.
| Compound Name | tert-butyl (2S)-3-methyl-2-[2-[1-[[(2S)-1-phenylpropan-2-yl]carbamoyloxymethyl]pyridin-1-ium-3-yl]ethyl]butanoate |
|---|---|
| PubChem CID | 159984361 |
| Molecular Formula | C27H39N2O4+ |
| Molecular Weight | 455.62 g/mol |
| Exact Mass | 455.29 |
| IUPAC Name | tert-butyl (2S)-3-methyl-2-[2-[1-[[(2S)-1-phenylpropan-2-yl]carbamoyloxymethyl]pyridin-1-ium-3-yl]ethyl]butanoate |
| SMILES | CC(C)[C@H](CCc1ccc[n+](COC(=O)N[C@@H](C)Cc2ccccc2)c1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H38N2O4/c1-20(2)24(25(30)33-27(4,5)6)15-14-23-13-10-16-29(18-23)19-32-26(31)28-21(3)17-22-11-8-7-9-12-22/h7-13,16,18,20-21,24H,14-15,17,19H2,1-6H3/p+1/t21-,24-/m0/s1 |
| InChIKey | OTUPVHBMCWAPSX-URXFXBBRSA-O |
| XLogP | 4.84 |
| TPSA | 68.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.62 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|