C23H30N3O5+ — CID 153488806
propan-2-yl (2S)-2-[[1-[[(2S)-1-phenylpropan-2-yl]carbamoyloxymethyl]pyridin-1-ium-4-carbonyl]amino]propanoate (PubChem CID 153488806) has the molecular formula C23H30N3O5+ and a molecular weight of 428.51 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[1-[[(2S)-1-phenylpropan-2-yl]carbamoyloxymethyl]pyridin-1-ium-4-carbonyl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[1-[[(2S)-1-phenylpropan-2-yl]carbamoyloxymethyl]pyridin-1-ium-4-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 153488806 |
| Molecular Formula | C23H30N3O5+ |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | propan-2-yl (2S)-2-[[1-[[(2S)-1-phenylpropan-2-yl]carbamoyloxymethyl]pyridin-1-ium-4-carbonyl]amino]propanoate |
| SMILES | CC(C)OC(=O)[C@H](C)NC(=O)c1cc[n+](COC(=O)N[C@@H](C)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C23H29N3O5/c1-16(2)31-22(28)18(4)25-21(27)20-10-12-26(13-11-20)15-30-23(29)24-17(3)14-19-8-6-5-7-9-19/h5-13,16-18H,14-15H2,1-4H3,(H-,24,25,27,29)/p+1/t17-,18-/m0/s1 |
| InChIKey | MDPFGUHKSYVLDR-ROUUACIJSA-O |
| XLogP | 2.36 |
| TPSA | 97.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|