C23H31N4O4+ — CID 153488828
[4-[[(2S,3S)-1-amino-3-methyl-1-oxopentan-2-yl]carbamoyl]pyridin-1-ium-1-yl]methyl N-[(2S)-1-phenylpropan-2-yl]carbamate (PubChem CID 153488828) has the molecular formula C23H31N4O4+ and a molecular weight of 427.53 g/mol. Its IUPAC name is [4-[[(2S,3S)-1-amino-3-methyl-1-oxopentan-2-yl]carbamoyl]pyridin-1-ium-1-yl]methyl N-[(2S)-1-phenylpropan-2-yl]carbamate.
| Compound Name | [4-[[(2S,3S)-1-amino-3-methyl-1-oxopentan-2-yl]carbamoyl]pyridin-1-ium-1-yl]methyl N-[(2S)-1-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 153488828 |
| Molecular Formula | C23H31N4O4+ |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.23 |
| IUPAC Name | [4-[[(2S,3S)-1-amino-3-methyl-1-oxopentan-2-yl]carbamoyl]pyridin-1-ium-1-yl]methyl N-[(2S)-1-phenylpropan-2-yl]carbamate |
| SMILES | CC[C@H](C)[C@H](NC(=O)c1cc[n+](COC(=O)N[C@@H](C)Cc2ccccc2)cc1)C(N)=O |
| InChI | InChI=1S/C23H30N4O4/c1-4-16(2)20(21(24)28)26-22(29)19-10-12-27(13-11-19)15-31-23(30)25-17(3)14-18-8-6-5-7-9-18/h5-13,16-17,20H,4,14-15H2,1-3H3,(H3-,24,25,26,28,29,30)/p+1/t16-,17-,20-/m0/s1 |
| InChIKey | GFAGIAQTPKJVJF-ZWOKBUDYSA-O |
| XLogP | 1.92 |
| TPSA | 114.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|