C21H29FN4O2 — CID 15998462
N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-3-[3-(2-fluorophenyl)-1,2,4-oxadiazol-5-yl]propanamide (PubChem CID 15998462) has the molecular formula C21H29FN4O2 and a molecular weight of 388.49 g/mol. Its IUPAC name is N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-3-[3-(2-fluorophenyl)-1,2,4-oxadiazol-5-yl]propanamide.
| Compound Name | N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-3-[3-(2-fluorophenyl)-1,2,4-oxadiazol-5-yl]propanamide |
|---|---|
| PubChem CID | 15998462 |
| Molecular Formula | C21H29FN4O2 |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.23 |
| IUPAC Name | N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-3-[3-(2-fluorophenyl)-1,2,4-oxadiazol-5-yl]propanamide |
| SMILES | CC1CC(C)CN(CCCNC(=O)CCc2nc(-c3ccccc3F)no2)C1 |
| InChI | InChI=1S/C21H29FN4O2/c1-15-12-16(2)14-26(13-15)11-5-10-23-19(27)8-9-20-24-21(25-28-20)17-6-3-4-7-18(17)22/h3-4,6-7,15-16H,5,8-14H2,1-2H3,(H,23,27) |
| InChIKey | SQUSEIZJSFIEBD-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|