C19H26FN5O2 — CID 15999074
3-[3-(2-fluorophenyl)-1,2,4-oxadiazol-5-yl]-N-[3-(4-methylpiperazin-1-yl)propyl]propanamide (PubChem CID 15999074) has the molecular formula C19H26FN5O2 and a molecular weight of 375.45 g/mol. Its IUPAC name is 3-[3-(2-fluorophenyl)-1,2,4-oxadiazol-5-yl]-N-[3-(4-methylpiperazin-1-yl)propyl]propanamide.
| Compound Name | 3-[3-(2-fluorophenyl)-1,2,4-oxadiazol-5-yl]-N-[3-(4-methylpiperazin-1-yl)propyl]propanamide |
|---|---|
| PubChem CID | 15999074 |
| Molecular Formula | C19H26FN5O2 |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.21 |
| IUPAC Name | 3-[3-(2-fluorophenyl)-1,2,4-oxadiazol-5-yl]-N-[3-(4-methylpiperazin-1-yl)propyl]propanamide |
| SMILES | CN1CCN(CCCNC(=O)CCc2nc(-c3ccccc3F)no2)CC1 |
| InChI | InChI=1S/C19H26FN5O2/c1-24-11-13-25(14-12-24)10-4-9-21-17(26)7-8-18-22-19(23-27-18)15-5-2-3-6-16(15)20/h2-3,5-6H,4,7-14H2,1H3,(H,21,26) |
| InChIKey | AQRKFFLERDBYSH-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 74.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|