C19H15Cl2NO3 — CID 159995881
(4-chloro-2,3-dihydroxyphenyl)-(6-chloro-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-2-yl)methanone (PubChem CID 159995881) has the molecular formula C19H15Cl2NO3 and a molecular weight of 376.24 g/mol. Its IUPAC name is (4-chloro-2,3-dihydroxyphenyl)-(6-chloro-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-2-yl)methanone.
| Compound Name | (4-chloro-2,3-dihydroxyphenyl)-(6-chloro-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-2-yl)methanone |
|---|---|
| PubChem CID | 159995881 |
| Molecular Formula | C19H15Cl2NO3 |
| Molecular Weight | 376.24 g/mol |
| Exact Mass | 375.04 |
| IUPAC Name | (4-chloro-2,3-dihydroxyphenyl)-(6-chloro-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-2-yl)methanone |
| SMILES | O=C(c1ccc(Cl)c(O)c1O)N1CCC2=C(Cc3ccc(Cl)cc32)C1 |
| InChI | InChI=1S/C19H15Cl2NO3/c20-12-2-1-10-7-11-9-22(6-5-13(11)15(10)8-12)19(25)14-3-4-16(21)18(24)17(14)23/h1-4,8,23-24H,5-7,9H2 |
| InChIKey | OHNNNKUQYDPUDI-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.24 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|