C28H27N5O5 — CID 15999686
9-methyl-10-[4-[4-(4-nitrophenyl)piperazine-1-carbonyl]phenyl]-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2,4,6-trien-11-one (PubChem CID 15999686) has the molecular formula C28H27N5O5 and a molecular weight of 513.55 g/mol. Its IUPAC name is 9-methyl-10-[4-[4-(4-nitrophenyl)piperazine-1-carbonyl]phenyl]-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2,4,6-trien-11-one.
| Compound Name | 9-methyl-10-[4-[4-(4-nitrophenyl)piperazine-1-carbonyl]phenyl]-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2,4,6-trien-11-one |
|---|---|
| PubChem CID | 15999686 |
| Molecular Formula | C28H27N5O5 |
| Molecular Weight | 513.55 g/mol |
| Exact Mass | 513.20 |
| IUPAC Name | 9-methyl-10-[4-[4-(4-nitrophenyl)piperazine-1-carbonyl]phenyl]-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2,4,6-trien-11-one |
| SMILES | CC12CC(NC(=O)N1c1ccc(C(=O)N3CCN(c4ccc([N+](=O)[O-])cc4)CC3)cc1)c1ccccc1O2 |
| InChI | InChI=1S/C28H27N5O5/c1-28-18-24(23-4-2-3-5-25(23)38-28)29-27(35)32(28)21-8-6-19(7-9-21)26(34)31-16-14-30(15-17-31)20-10-12-22(13-11-20)33(36)37/h2-13,24H,14-18H2,1H3,(H,29,35) |
| InChIKey | FQXLNNUUKYRTLC-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 108.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.55 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|