C16H13F2IO6 — CID 160501658
2-fluoro-5-iodo-4-methoxybenzoic acid;2-fluoro-4-methoxybenzoic acid (PubChem CID 160501658) has the molecular formula C16H13F2IO6 and a molecular weight of 466.17 g/mol. Its IUPAC name is 2-fluoro-5-iodo-4-methoxybenzoic acid;2-fluoro-4-methoxybenzoic acid.
| Compound Name | 2-fluoro-5-iodo-4-methoxybenzoic acid;2-fluoro-4-methoxybenzoic acid |
|---|---|
| PubChem CID | 160501658 |
| Molecular Formula | C16H13F2IO6 |
| Molecular Weight | 466.17 g/mol |
| Exact Mass | 465.97 |
| IUPAC Name | 2-fluoro-5-iodo-4-methoxybenzoic acid;2-fluoro-4-methoxybenzoic acid |
| SMILES | COc1cc(F)c(C(=O)O)cc1I.COc1ccc(C(=O)O)c(F)c1 |
| InChI | InChI=1S/C8H6FIO3.C8H7FO3/c1-13-7-3-5(9)4(8(11)12)2-6(7)10;1-12-5-2-3-6(8(10)11)7(9)4-5/h2-3H,1H3,(H,11,12);2-4H,1H3,(H,10,11) |
| InChIKey | QRWASQNOIHSPFF-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.17 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|