C29H34N4O3 — CID 160503317
3-(dimethylamino)-5-methyl-N-[(2R)-7-[(7-oxo-6,8-dihydro-5H-1,8-naphthyridin-4-yl)oxy]-1,2,3,4-tetrahydronaphthalen-2-yl]benzamide;methane (PubChem CID 160503317) has the molecular formula C29H34N4O3 and a molecular weight of 486.62 g/mol. Its IUPAC name is 3-(dimethylamino)-5-methyl-N-[(2R)-7-[(7-oxo-6,8-dihydro-5H-1,8-naphthyridin-4-yl)oxy]-1,2,3,4-tetrahydronaphthalen-2-yl]benzamide;methane.
| Compound Name | 3-(dimethylamino)-5-methyl-N-[(2R)-7-[(7-oxo-6,8-dihydro-5H-1,8-naphthyridin-4-yl)oxy]-1,2,3,4-tetrahydronaphthalen-2-yl]benzamide;methane |
|---|---|
| PubChem CID | 160503317 |
| Molecular Formula | C29H34N4O3 |
| Molecular Weight | 486.62 g/mol |
| Exact Mass | 486.26 |
| IUPAC Name | 3-(dimethylamino)-5-methyl-N-[(2R)-7-[(7-oxo-6,8-dihydro-5H-1,8-naphthyridin-4-yl)oxy]-1,2,3,4-tetrahydronaphthalen-2-yl]benzamide;methane |
| SMILES | C.Cc1cc(C(=O)N[C@@H]2CCc3ccc(Oc4ccnc5c4CCC(=O)N5)cc3C2)cc(N(C)C)c1 |
| InChI | InChI=1S/C28H30N4O3.CH4/c1-17-12-20(15-22(13-17)32(2)3)28(34)30-21-6-4-18-5-7-23(16-19(18)14-21)35-25-10-11-29-27-24(25)8-9-26(33)31-27;/h5,7,10-13,15-16,21H,4,6,8-9,14H2,1-3H3,(H,30,34)(H,29,31,33);1H4/t21-;/m1./s1 |
| InChIKey | QSBNUFNDRZKPMV-ZMBIFBSDSA-N |
| XLogP | 5.06 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.62 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |