C31H33N3O3 — CID 70861307
3-cyclohexyl-N-[(2R)-7-[(7-oxo-6,8-dihydro-5H-1,8-naphthyridin-4-yl)oxy]-1,2,3,4-tetrahydronaphthalen-2-yl]benzamide (PubChem CID 70861307) has the molecular formula C31H33N3O3 and a molecular weight of 495.62 g/mol. Its IUPAC name is 3-cyclohexyl-N-[(2R)-7-[(7-oxo-6,8-dihydro-5H-1,8-naphthyridin-4-yl)oxy]-1,2,3,4-tetrahydronaphthalen-2-yl]benzamide.
| Compound Name | 3-cyclohexyl-N-[(2R)-7-[(7-oxo-6,8-dihydro-5H-1,8-naphthyridin-4-yl)oxy]-1,2,3,4-tetrahydronaphthalen-2-yl]benzamide |
|---|---|
| PubChem CID | 70861307 |
| Molecular Formula | C31H33N3O3 |
| Molecular Weight | 495.62 g/mol |
| Exact Mass | 495.25 |
| IUPAC Name | 3-cyclohexyl-N-[(2R)-7-[(7-oxo-6,8-dihydro-5H-1,8-naphthyridin-4-yl)oxy]-1,2,3,4-tetrahydronaphthalen-2-yl]benzamide |
| SMILES | O=C1CCc2c(Oc3ccc4c(c3)C[C@H](NC(=O)c3cccc(C5CCCCC5)c3)CC4)ccnc2N1 |
| InChI | InChI=1S/C31H33N3O3/c35-29-14-13-27-28(15-16-32-30(27)34-29)37-26-12-10-21-9-11-25(18-24(21)19-26)33-31(36)23-8-4-7-22(17-23)20-5-2-1-3-6-20/h4,7-8,10,12,15-17,19-20,25H,1-3,5-6,9,11,13-14,18H2,(H,33,36)(H,32,34,35)/t25-/m1/s1 |
| InChIKey | IIIDDVPLVPTNDT-RUZDIDTESA-N |
| XLogP | 6.09 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.62 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |