C25H30N4O3 — CID 129192112
5-[3-[(1S,2S,3S)-1-[(cyclohexylamino)methylamino]-2-bicyclo[1.1.0]butanyl]-4-hydroxyphenoxy]-3,4-dihydro-1H-1,8-naphthyridin-2-one (PubChem CID 129192112) has the molecular formula C25H30N4O3 and a molecular weight of 434.54 g/mol. Its IUPAC name is 5-[3-[(1S,2S,3S)-1-[(cyclohexylamino)methylamino]-2-bicyclo[1.1.0]butanyl]-4-hydroxyphenoxy]-3,4-dihydro-1H-1,8-naphthyridin-2-one.
| Compound Name | 5-[3-[(1S,2S,3S)-1-[(cyclohexylamino)methylamino]-2-bicyclo[1.1.0]butanyl]-4-hydroxyphenoxy]-3,4-dihydro-1H-1,8-naphthyridin-2-one |
|---|---|
| PubChem CID | 129192112 |
| Molecular Formula | C25H30N4O3 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | 5-[3-[(1S,2S,3S)-1-[(cyclohexylamino)methylamino]-2-bicyclo[1.1.0]butanyl]-4-hydroxyphenoxy]-3,4-dihydro-1H-1,8-naphthyridin-2-one |
| SMILES | O=C1CCc2c(Oc3ccc(O)c([C@@H]4[C@@H]5C[C@@]45NCNC4CCCCC4)c3)ccnc2N1 |
| InChI | InChI=1S/C25H30N4O3/c30-20-8-6-16(32-21-10-11-26-24-17(21)7-9-22(31)29-24)12-18(20)23-19-13-25(19,23)28-14-27-15-4-2-1-3-5-15/h6,8,10-12,15,19,23,27-28,30H,1-5,7,9,13-14H2,(H,26,29,31)/t19-,23+,25-/m0/s1 |
| InChIKey | JXFRHMYZUVGPOD-CYSDGLOUSA-N |
| XLogP | 3.79 |
| TPSA | 95.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|