C21H20N2O5 — CID 129189492
ethyl (1S,2S,3S)-2-[2-hydroxy-5-[(7-oxo-6,8-dihydro-5H-1,8-naphthyridin-4-yl)oxy]phenyl]bicyclo[1.1.0]butane-1-carboxylate (PubChem CID 129189492) has the molecular formula C21H20N2O5 and a molecular weight of 380.40 g/mol. Its IUPAC name is ethyl (1S,2S,3S)-2-[2-hydroxy-5-[(7-oxo-6,8-dihydro-5H-1,8-naphthyridin-4-yl)oxy]phenyl]bicyclo[1.1.0]butane-1-carboxylate.
| Compound Name | ethyl (1S,2S,3S)-2-[2-hydroxy-5-[(7-oxo-6,8-dihydro-5H-1,8-naphthyridin-4-yl)oxy]phenyl]bicyclo[1.1.0]butane-1-carboxylate |
|---|---|
| PubChem CID | 129189492 |
| Molecular Formula | C21H20N2O5 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | ethyl (1S,2S,3S)-2-[2-hydroxy-5-[(7-oxo-6,8-dihydro-5H-1,8-naphthyridin-4-yl)oxy]phenyl]bicyclo[1.1.0]butane-1-carboxylate |
| SMILES | CCOC(=O)[C@@]12C[C@H]1[C@H]2c1cc(Oc2ccnc3c2CCC(=O)N3)ccc1O |
| InChI | InChI=1S/C21H20N2O5/c1-2-27-20(26)21-10-14(21)18(21)13-9-11(3-5-15(13)24)28-16-7-8-22-19-12(16)4-6-17(25)23-19/h3,5,7-9,14,18,24H,2,4,6,10H2,1H3,(H,22,23,25)/t14-,18+,21-/m0/s1 |
| InChIKey | XWTBCGXCXJJGLY-HLLQZAQXSA-N |
| XLogP | 3.13 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |