C25H20F2N4O4 — CID 129191935
1-(2,5-difluorophenyl)-3-[(1S,2S,3S)-2-[2-hydroxy-5-[(7-oxo-6,8-dihydro-5H-1,8-naphthyridin-4-yl)oxy]phenyl]-1-bicyclo[1.1.0]butanyl]urea (PubChem CID 129191935) has the molecular formula C25H20F2N4O4 and a molecular weight of 478.46 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)-3-[(1S,2S,3S)-2-[2-hydroxy-5-[(7-oxo-6,8-dihydro-5H-1,8-naphthyridin-4-yl)oxy]phenyl]-1-bicyclo[1.1.0]butanyl]urea.
| Compound Name | 1-(2,5-difluorophenyl)-3-[(1S,2S,3S)-2-[2-hydroxy-5-[(7-oxo-6,8-dihydro-5H-1,8-naphthyridin-4-yl)oxy]phenyl]-1-bicyclo[1.1.0]butanyl]urea |
|---|---|
| PubChem CID | 129191935 |
| Molecular Formula | C25H20F2N4O4 |
| Molecular Weight | 478.46 g/mol |
| Exact Mass | 478.15 |
| IUPAC Name | 1-(2,5-difluorophenyl)-3-[(1S,2S,3S)-2-[2-hydroxy-5-[(7-oxo-6,8-dihydro-5H-1,8-naphthyridin-4-yl)oxy]phenyl]-1-bicyclo[1.1.0]butanyl]urea |
| SMILES | O=C1CCc2c(Oc3ccc(O)c([C@@H]4[C@@H]5C[C@@]45NC(=O)Nc4cc(F)ccc4F)c3)ccnc2N1 |
| InChI | InChI=1S/C25H20F2N4O4/c26-12-1-4-17(27)18(9-12)29-24(34)31-25-11-16(25)22(25)15-10-13(2-5-19(15)32)35-20-7-8-28-23-14(20)3-6-21(33)30-23/h1-2,4-5,7-10,16,22,32H,3,6,11H2,(H,28,30,33)(H2,29,31,34)/t16-,22+,25-/m0/s1 |
| InChIKey | ANEDLGBFBUDIGW-HKFAVZMWSA-N |
| XLogP | 4.42 |
| TPSA | 112.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.46 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |