C31H31F3N6O4 — CID 129191989
1-[(1S,2S,3S)-2-[2-hydroxy-5-[(7-oxo-6,8-dihydro-5H-1,8-naphthyridin-4-yl)oxy]phenyl]-1-bicyclo[1.1.0]butanyl]-3-[4-(4-methylpiperazin-1-yl)-3-(trifluoromethyl)phenyl]urea (PubChem CID 129191989) has the molecular formula C31H31F3N6O4 and a molecular weight of 608.62 g/mol. Its IUPAC name is 1-[(1S,2S,3S)-2-[2-hydroxy-5-[(7-oxo-6,8-dihydro-5H-1,8-naphthyridin-4-yl)oxy]phenyl]-1-bicyclo[1.1.0]butanyl]-3-[4-(4-methylpiperazin-1-yl)-3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[(1S,2S,3S)-2-[2-hydroxy-5-[(7-oxo-6,8-dihydro-5H-1,8-naphthyridin-4-yl)oxy]phenyl]-1-bicyclo[1.1.0]butanyl]-3-[4-(4-methylpiperazin-1-yl)-3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 129191989 |
| Molecular Formula | C31H31F3N6O4 |
| Molecular Weight | 608.62 g/mol |
| Exact Mass | 608.24 |
| IUPAC Name | 1-[(1S,2S,3S)-2-[2-hydroxy-5-[(7-oxo-6,8-dihydro-5H-1,8-naphthyridin-4-yl)oxy]phenyl]-1-bicyclo[1.1.0]butanyl]-3-[4-(4-methylpiperazin-1-yl)-3-(trifluoromethyl)phenyl]urea |
| SMILES | CN1CCN(c2ccc(NC(=O)N[C@@]34C[C@H]3[C@H]4c3cc(Oc4ccnc5c4CCC(=O)N5)ccc3O)cc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C31H31F3N6O4/c1-39-10-12-40(13-11-39)23-5-2-17(14-21(23)31(32,33)34)36-29(43)38-30-16-22(30)27(30)20-15-18(3-6-24(20)41)44-25-8-9-35-28-19(25)4-7-26(42)37-28/h2-3,5-6,8-9,14-15,22,27,41H,4,7,10-13,16H2,1H3,(H,35,37,42)(H2,36,38,43)/t22-,27+,30-/m0/s1 |
| InChIKey | MIGQONHKCLDZPM-OQTGDVNSSA-N |
| XLogP | 4.91 |
| TPSA | 119.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.62 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|