C24H20ClN5O4 — CID 129192111
1-(4-chloro-2-pyridinyl)-3-[(1S,2S,3S)-2-[2-hydroxy-5-[(7-oxo-6,8-dihydro-5H-1,8-naphthyridin-4-yl)oxy]phenyl]-1-bicyclo[1.1.0]butanyl]urea (PubChem CID 129192111) has the molecular formula C24H20ClN5O4 and a molecular weight of 477.91 g/mol. Its IUPAC name is 1-(4-chloro-2-pyridinyl)-3-[(1S,2S,3S)-2-[2-hydroxy-5-[(7-oxo-6,8-dihydro-5H-1,8-naphthyridin-4-yl)oxy]phenyl]-1-bicyclo[1.1.0]butanyl]urea.
| Compound Name | 1-(4-chloro-2-pyridinyl)-3-[(1S,2S,3S)-2-[2-hydroxy-5-[(7-oxo-6,8-dihydro-5H-1,8-naphthyridin-4-yl)oxy]phenyl]-1-bicyclo[1.1.0]butanyl]urea |
|---|---|
| PubChem CID | 129192111 |
| Molecular Formula | C24H20ClN5O4 |
| Molecular Weight | 477.91 g/mol |
| Exact Mass | 477.12 |
| IUPAC Name | 1-(4-chloro-2-pyridinyl)-3-[(1S,2S,3S)-2-[2-hydroxy-5-[(7-oxo-6,8-dihydro-5H-1,8-naphthyridin-4-yl)oxy]phenyl]-1-bicyclo[1.1.0]butanyl]urea |
| SMILES | O=C1CCc2c(Oc3ccc(O)c([C@@H]4[C@@H]5C[C@@]45NC(=O)Nc4cc(Cl)ccn4)c3)ccnc2N1 |
| InChI | InChI=1S/C24H20ClN5O4/c25-12-5-7-26-19(9-12)28-23(33)30-24-11-16(24)21(24)15-10-13(1-3-17(15)31)34-18-6-8-27-22-14(18)2-4-20(32)29-22/h1,3,5-10,16,21,31H,2,4,11H2,(H,27,29,32)(H2,26,28,30,33)/t16-,21+,24-/m0/s1 |
| InChIKey | UBYPGIQPUJMLSG-FBOFTVOISA-N |
| XLogP | 4.19 |
| TPSA | 125.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.91 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |