C25H19F4N5O4 — CID 147615250
1-[4-fluoro-3-(trifluoromethyl)phenyl]-3-[(1S,2S,3S)-2-[2-hydroxy-5-[(2-oxo-3,4-dihydro-1H-pyrido[2,3-d]pyrimidin-5-yl)oxy]phenyl]-1-bicyclo[1.1.0]butanyl]urea (PubChem CID 147615250) has the molecular formula C25H19F4N5O4 and a molecular weight of 529.45 g/mol. Its IUPAC name is 1-[4-fluoro-3-(trifluoromethyl)phenyl]-3-[(1S,2S,3S)-2-[2-hydroxy-5-[(2-oxo-3,4-dihydro-1H-pyrido[2,3-d]pyrimidin-5-yl)oxy]phenyl]-1-bicyclo[1.1.0]butanyl]urea.
| Compound Name | 1-[4-fluoro-3-(trifluoromethyl)phenyl]-3-[(1S,2S,3S)-2-[2-hydroxy-5-[(2-oxo-3,4-dihydro-1H-pyrido[2,3-d]pyrimidin-5-yl)oxy]phenyl]-1-bicyclo[1.1.0]butanyl]urea |
|---|---|
| PubChem CID | 147615250 |
| Molecular Formula | C25H19F4N5O4 |
| Molecular Weight | 529.45 g/mol |
| Exact Mass | 529.14 |
| IUPAC Name | 1-[4-fluoro-3-(trifluoromethyl)phenyl]-3-[(1S,2S,3S)-2-[2-hydroxy-5-[(2-oxo-3,4-dihydro-1H-pyrido[2,3-d]pyrimidin-5-yl)oxy]phenyl]-1-bicyclo[1.1.0]butanyl]urea |
| SMILES | O=C1NCc2c(Oc3ccc(O)c([C@@H]4[C@@H]5C[C@@]45NC(=O)Nc4ccc(F)c(C(F)(F)F)c4)c3)ccnc2N1 |
| InChI | InChI=1S/C25H19F4N5O4/c26-17-3-1-11(7-15(17)25(27,28)29)32-23(37)34-24-9-16(24)20(24)13-8-12(2-4-18(13)35)38-19-5-6-30-21-14(19)10-31-22(36)33-21/h1-8,16,20,35H,9-10H2,(H2,32,34,37)(H2,30,31,33,36)/t16-,20+,24-/m0/s1 |
| InChIKey | GCUDXMUHTAFMKG-GANZUKCXSA-N |
| XLogP | 5.05 |
| TPSA | 124.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.45 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |