C29H33N13O4 — CID 160510726
N-(4-azidocyclohexyl)-N-methyl-2,1,3-benzoxadiazole-5-carboxamide;N-methyl-N-[4-(tetrazol-2-yl)cyclohexyl]-2,1,3-benzoxadiazole-5-carboxamide (PubChem CID 160510726) has the molecular formula C29H33N13O4 and a molecular weight of 627.67 g/mol. Its IUPAC name is N-(4-azidocyclohexyl)-N-methyl-2,1,3-benzoxadiazole-5-carboxamide;N-methyl-N-[4-(tetrazol-2-yl)cyclohexyl]-2,1,3-benzoxadiazole-5-carboxamide.
| Compound Name | N-(4-azidocyclohexyl)-N-methyl-2,1,3-benzoxadiazole-5-carboxamide;N-methyl-N-[4-(tetrazol-2-yl)cyclohexyl]-2,1,3-benzoxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 160510726 |
| Molecular Formula | C29H33N13O4 |
| Molecular Weight | 627.67 g/mol |
| Exact Mass | 627.28 |
| IUPAC Name | N-(4-azidocyclohexyl)-N-methyl-2,1,3-benzoxadiazole-5-carboxamide;N-methyl-N-[4-(tetrazol-2-yl)cyclohexyl]-2,1,3-benzoxadiazole-5-carboxamide |
| SMILES | CN(C(=O)c1ccc2nonc2c1)C1CCC(N=[N+]=[N-])CC1.CN(C(=O)c1ccc2nonc2c1)C1CCC(n2ncnn2)CC1 |
| InChI | InChI=1S/C15H17N7O2.C14H16N6O2/c1-21(11-3-5-12(6-4-11)22-17-9-16-20-22)15(23)10-2-7-13-14(8-10)19-24-18-13;1-20(11-5-3-10(4-6-11)16-19-15)14(21)9-2-7-12-13(8-9)18-22-17-12/h2,7-9,11-12H,3-6H2,1H3;2,7-8,10-11H,3-6H2,1H3 |
| InChIKey | QSZXIFQKHLHVCJ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 210.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.67 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|