C24H22ClIN4O6S2 — CID 160510765
2-[bis[(4-methoxyphenyl)methyl]sulfamoyl]-4-iodo-3-(3H-1,2,4-triazol-5-yl)benzenesulfonyl chloride (PubChem CID 160510765) has the molecular formula C24H22ClIN4O6S2 and a molecular weight of 688.95 g/mol. Its IUPAC name is 2-[bis[(4-methoxyphenyl)methyl]sulfamoyl]-4-iodo-3-(3H-1,2,4-triazol-5-yl)benzenesulfonyl chloride.
| Compound Name | 2-[bis[(4-methoxyphenyl)methyl]sulfamoyl]-4-iodo-3-(3H-1,2,4-triazol-5-yl)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 160510765 |
| Molecular Formula | C24H22ClIN4O6S2 |
| Molecular Weight | 688.95 g/mol |
| Exact Mass | 687.97 |
| IUPAC Name | 2-[bis[(4-methoxyphenyl)methyl]sulfamoyl]-4-iodo-3-(3H-1,2,4-triazol-5-yl)benzenesulfonyl chloride |
| SMILES | COc1ccc(CN(Cc2ccc(OC)cc2)S(=O)(=O)c2c(S(=O)(=O)Cl)ccc(I)c2C2=NCN=N2)cc1 |
| InChI | InChI=1S/C24H22ClIN4O6S2/c1-35-18-7-3-16(4-8-18)13-30(14-17-5-9-19(36-2)10-6-17)38(33,34)23-21(37(25,31)32)12-11-20(26)22(23)24-27-15-28-29-24/h3-12H,13-15H2,1-2H3 |
| InChIKey | YZQBFHUZKRQYPE-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 127.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.95 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|