C11H6F3N2NaO3 — CID 160510816
sodium 4-hydroxy-3-[3-(trifluoromethyl)phenyl]-1H-pyrazole-5-carboxylate (PubChem CID 160510816) has the molecular formula C11H6F3N2NaO3 and a molecular weight of 294.16 g/mol. Its IUPAC name is sodium 4-hydroxy-3-[3-(trifluoromethyl)phenyl]-1H-pyrazole-5-carboxylate.
| Compound Name | sodium 4-hydroxy-3-[3-(trifluoromethyl)phenyl]-1H-pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 160510816 |
| Molecular Formula | C11H6F3N2NaO3 |
| Molecular Weight | 294.16 g/mol |
| Exact Mass | 294.02 |
| IUPAC Name | sodium 4-hydroxy-3-[3-(trifluoromethyl)phenyl]-1H-pyrazole-5-carboxylate |
| SMILES | O=C([O-])c1[nH]nc(-c2cccc(C(F)(F)F)c2)c1O.[Na+] |
| InChI | InChI=1S/C11H7F3N2O3.Na/c12-11(13,14)6-3-1-2-5(4-6)7-9(17)8(10(18)19)16-15-7;/h1-4,17H,(H,15,16)(H,18,19);/q;+1/p-1 |
| InChIKey | QTADUFUBALVHDE-UHFFFAOYSA-M |
| XLogP | -1.83 |
| TPSA | 89.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.16 |
| LogP ≤ 5 | -1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |