C10H4F3N2O2S- — CID 23365075
5-[3-(trifluoromethyl)phenyl]-1,2,4-thiadiazole-3-carboxylate (PubChem CID 23365075) has the molecular formula C10H4F3N2O2S- and a molecular weight of 273.22 g/mol. Its IUPAC name is 5-[3-(trifluoromethyl)phenyl]-1,2,4-thiadiazole-3-carboxylate.
| Compound Name | 5-[3-(trifluoromethyl)phenyl]-1,2,4-thiadiazole-3-carboxylate |
|---|---|
| PubChem CID | 23365075 |
| Molecular Formula | C10H4F3N2O2S- |
| Molecular Weight | 273.22 g/mol |
| Exact Mass | 273.00 |
| IUPAC Name | 5-[3-(trifluoromethyl)phenyl]-1,2,4-thiadiazole-3-carboxylate |
| SMILES | O=C([O-])c1nsc(-c2cccc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C10H5F3N2O2S/c11-10(12,13)6-3-1-2-5(4-6)8-14-7(9(16)17)15-18-8/h1-4H,(H,16,17)/p-1 |
| InChIKey | CCAPIZHUHIMGSY-UHFFFAOYSA-M |
| XLogP | 1.59 |
| TPSA | 65.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.22 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |