C16H7F6N3OS — CID 167825430
3,4,5-trifluoro-N-[3-[3-(trifluoromethyl)phenyl]-1,2,4-thiadiazol-5-yl]benzamide (PubChem CID 167825430) has the molecular formula C16H7F6N3OS and a molecular weight of 403.31 g/mol. Its IUPAC name is 3,4,5-trifluoro-N-[3-[3-(trifluoromethyl)phenyl]-1,2,4-thiadiazol-5-yl]benzamide.
| Compound Name | 3,4,5-trifluoro-N-[3-[3-(trifluoromethyl)phenyl]-1,2,4-thiadiazol-5-yl]benzamide |
|---|---|
| PubChem CID | 167825430 |
| Molecular Formula | C16H7F6N3OS |
| Molecular Weight | 403.31 g/mol |
| Exact Mass | 403.02 |
| IUPAC Name | 3,4,5-trifluoro-N-[3-[3-(trifluoromethyl)phenyl]-1,2,4-thiadiazol-5-yl]benzamide |
| SMILES | O=C(Nc1nc(-c2cccc(C(F)(F)F)c2)ns1)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C16H7F6N3OS/c17-10-5-8(6-11(18)12(10)19)14(26)24-15-23-13(25-27-15)7-2-1-3-9(4-7)16(20,21)22/h1-6H,(H,23,24,25,26) |
| InChIKey | RHUPLTAGMGAPFU-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.31 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|