C16H11F2N3O2S — CID 122149641
N-(3-benzyl-1,2,4-thiadiazol-5-yl)-3,5-difluoro-4-hydroxybenzamide (PubChem CID 122149641) has the molecular formula C16H11F2N3O2S and a molecular weight of 347.35 g/mol. Its IUPAC name is N-(3-benzyl-1,2,4-thiadiazol-5-yl)-3,5-difluoro-4-hydroxybenzamide.
| Compound Name | N-(3-benzyl-1,2,4-thiadiazol-5-yl)-3,5-difluoro-4-hydroxybenzamide |
|---|---|
| PubChem CID | 122149641 |
| Molecular Formula | C16H11F2N3O2S |
| Molecular Weight | 347.35 g/mol |
| Exact Mass | 347.05 |
| IUPAC Name | N-(3-benzyl-1,2,4-thiadiazol-5-yl)-3,5-difluoro-4-hydroxybenzamide |
| SMILES | O=C(Nc1nc(Cc2ccccc2)ns1)c1cc(F)c(O)c(F)c1 |
| InChI | InChI=1S/C16H11F2N3O2S/c17-11-7-10(8-12(18)14(11)22)15(23)20-16-19-13(21-24-16)6-9-4-2-1-3-5-9/h1-5,7-8,22H,6H2,(H,19,20,21,23) |
| InChIKey | NOLOSJKUWSYSID-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.35 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |