C18H24F2N2O11P2 — CID 160512800
2-fluoroethanol;1-[2-fluoroethoxy(methyl)phosphoryl]oxy-4-nitrobenzene;methyl-(4-nitrophenoxy)phosphinic acid (PubChem CID 160512800) has the molecular formula C18H24F2N2O11P2 and a molecular weight of 544.34 g/mol. Its IUPAC name is 2-fluoroethanol;1-[2-fluoroethoxy(methyl)phosphoryl]oxy-4-nitrobenzene;methyl-(4-nitrophenoxy)phosphinic acid.
| Compound Name | 2-fluoroethanol;1-[2-fluoroethoxy(methyl)phosphoryl]oxy-4-nitrobenzene;methyl-(4-nitrophenoxy)phosphinic acid |
|---|---|
| PubChem CID | 160512800 |
| Molecular Formula | C18H24F2N2O11P2 |
| Molecular Weight | 544.34 g/mol |
| Exact Mass | 544.08 |
| IUPAC Name | 2-fluoroethanol;1-[2-fluoroethoxy(methyl)phosphoryl]oxy-4-nitrobenzene;methyl-(4-nitrophenoxy)phosphinic acid |
| SMILES | CP(=O)(O)Oc1ccc([N+](=O)[O-])cc1.CP(=O)(OCCF)Oc1ccc([N+](=O)[O-])cc1.OCCF |
| InChI | InChI=1S/C9H11FNO5P.C7H8NO5P.C2H5FO/c1-17(14,15-7-6-10)16-9-4-2-8(3-5-9)11(12)13;1-14(11,12)13-7-4-2-6(3-5-7)8(9)10;3-1-2-4/h2-5H,6-7H2,1H3;2-5H,1H3,(H,11,12);4H,1-2H2 |
| InChIKey | QTGQBIBYNSDYPN-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 188.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.34 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|