C26H23F3N6O3 — CID 160514993
2-[3-[[2-(6-ethylpyrimidin-4-yl)-5-methylpyrazol-3-yl]amino]-4-methylphenyl]-1-[3-nitro-5-(trifluoromethyl)phenyl]ethanone (PubChem CID 160514993) has the molecular formula C26H23F3N6O3 and a molecular weight of 524.50 g/mol. Its IUPAC name is 2-[3-[[2-(6-ethylpyrimidin-4-yl)-5-methylpyrazol-3-yl]amino]-4-methylphenyl]-1-[3-nitro-5-(trifluoromethyl)phenyl]ethanone.
| Compound Name | 2-[3-[[2-(6-ethylpyrimidin-4-yl)-5-methylpyrazol-3-yl]amino]-4-methylphenyl]-1-[3-nitro-5-(trifluoromethyl)phenyl]ethanone |
|---|---|
| PubChem CID | 160514993 |
| Molecular Formula | C26H23F3N6O3 |
| Molecular Weight | 524.50 g/mol |
| Exact Mass | 524.18 |
| IUPAC Name | 2-[3-[[2-(6-ethylpyrimidin-4-yl)-5-methylpyrazol-3-yl]amino]-4-methylphenyl]-1-[3-nitro-5-(trifluoromethyl)phenyl]ethanone |
| SMILES | CCc1cc(-n2nc(C)cc2Nc2cc(CC(=O)c3cc([N+](=O)[O-])cc(C(F)(F)F)c3)ccc2C)ncn1 |
| InChI | InChI=1S/C26H23F3N6O3/c1-4-20-13-24(31-14-30-20)34-25(7-16(3)33-34)32-22-8-17(6-5-15(22)2)9-23(36)18-10-19(26(27,28)29)12-21(11-18)35(37)38/h5-8,10-14,32H,4,9H2,1-3H3 |
| InChIKey | GLJPLZNWPKRRMX-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 115.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.50 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|