C22H24FN5 — CID 160517168
4-(2-ethylbutylamino)-2-(4-fluoro-3-methylanilino)quinazoline-8-carbonitrile (PubChem CID 160517168) has the molecular formula C22H24FN5 and a molecular weight of 377.47 g/mol. Its IUPAC name is 4-(2-ethylbutylamino)-2-(4-fluoro-3-methylanilino)quinazoline-8-carbonitrile.
| Compound Name | 4-(2-ethylbutylamino)-2-(4-fluoro-3-methylanilino)quinazoline-8-carbonitrile |
|---|---|
| PubChem CID | 160517168 |
| Molecular Formula | C22H24FN5 |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | 4-(2-ethylbutylamino)-2-(4-fluoro-3-methylanilino)quinazoline-8-carbonitrile |
| SMILES | CCC(CC)CNc1nc(Nc2ccc(F)c(C)c2)nc2c(C#N)cccc12 |
| InChI | InChI=1S/C22H24FN5/c1-4-15(5-2)13-25-21-18-8-6-7-16(12-24)20(18)27-22(28-21)26-17-9-10-19(23)14(3)11-17/h6-11,15H,4-5,13H2,1-3H3,(H2,25,26,27,28) |
| InChIKey | REXLFHRHNWRGCK-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |