C8H8FN5 — CID 164653277
N-(4-fluoro-3-methylphenyl)-2H-tetrazol-5-amine (PubChem CID 164653277) has the molecular formula C8H8FN5 and a molecular weight of 193.19 g/mol. Its IUPAC name is N-(4-fluoro-3-methylphenyl)-2H-tetrazol-5-amine.
| Compound Name | N-(4-fluoro-3-methylphenyl)-2H-tetrazol-5-amine |
|---|---|
| PubChem CID | 164653277 |
| Molecular Formula | C8H8FN5 |
| Molecular Weight | 193.19 g/mol |
| Exact Mass | 193.08 |
| IUPAC Name | N-(4-fluoro-3-methylphenyl)-2H-tetrazol-5-amine |
| SMILES | Cc1cc(Nc2nn[nH]n2)ccc1F |
| InChI | InChI=1S/C8H8FN5/c1-5-4-6(2-3-7(5)9)10-8-11-13-14-12-8/h2-4H,1H3,(H2,10,11,12,13,14) |
| InChIKey | WYEFIXUYUPAHMB-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.19 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |