C23H36F3N3O2 — CID 160517239
N-[[4-[methyl(5-methylhexyl)amino]oxan-4-yl]methyl]-N-[6-(trifluoromethyl)-2-pyridinyl]propanamide (PubChem CID 160517239) has the molecular formula C23H36F3N3O2 and a molecular weight of 443.55 g/mol. Its IUPAC name is N-[[4-[methyl(5-methylhexyl)amino]oxan-4-yl]methyl]-N-[6-(trifluoromethyl)-2-pyridinyl]propanamide.
| Compound Name | N-[[4-[methyl(5-methylhexyl)amino]oxan-4-yl]methyl]-N-[6-(trifluoromethyl)-2-pyridinyl]propanamide |
|---|---|
| PubChem CID | 160517239 |
| Molecular Formula | C23H36F3N3O2 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.28 |
| IUPAC Name | N-[[4-[methyl(5-methylhexyl)amino]oxan-4-yl]methyl]-N-[6-(trifluoromethyl)-2-pyridinyl]propanamide |
| SMILES | CCC(=O)N(CC1(N(C)CCCCC(C)C)CCOCC1)c1cccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C23H36F3N3O2/c1-5-21(30)29(20-11-8-10-19(27-20)23(24,25)26)17-22(12-15-31-16-13-22)28(4)14-7-6-9-18(2)3/h8,10-11,18H,5-7,9,12-17H2,1-4H3 |
| InChIKey | QTUSVFBEYCVJIS-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|