C22H36N4O2 — CID 126509121
N-[[4-(4-butan-2-ylpiperazin-1-yl)oxan-4-yl]methyl]-N-pyridin-2-ylpropanamide (PubChem CID 126509121) has the molecular formula C22H36N4O2 and a molecular weight of 388.56 g/mol. Its IUPAC name is N-[[4-(4-butan-2-ylpiperazin-1-yl)oxan-4-yl]methyl]-N-pyridin-2-ylpropanamide.
| Compound Name | N-[[4-(4-butan-2-ylpiperazin-1-yl)oxan-4-yl]methyl]-N-pyridin-2-ylpropanamide |
|---|---|
| PubChem CID | 126509121 |
| Molecular Formula | C22H36N4O2 |
| Molecular Weight | 388.56 g/mol |
| Exact Mass | 388.28 |
| IUPAC Name | N-[[4-(4-butan-2-ylpiperazin-1-yl)oxan-4-yl]methyl]-N-pyridin-2-ylpropanamide |
| SMILES | CCC(=O)N(CC1(N2CCN(C(C)CC)CC2)CCOCC1)c1ccccn1 |
| InChI | InChI=1S/C22H36N4O2/c1-4-19(3)24-12-14-25(15-13-24)22(9-16-28-17-10-22)18-26(21(27)5-2)20-8-6-7-11-23-20/h6-8,11,19H,4-5,9-10,12-18H2,1-3H3 |
| InChIKey | ATULWTIBFBUBIH-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 48.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.56 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |