C27H32N4O2S — CID 139462043
N-[[4-(4-benzylpiperazin-1-yl)oxan-4-yl]methyl]-N-pyridin-2-ylthiophene-2-carboxamide (PubChem CID 139462043) has the molecular formula C27H32N4O2S and a molecular weight of 476.65 g/mol. Its IUPAC name is N-[[4-(4-benzylpiperazin-1-yl)oxan-4-yl]methyl]-N-pyridin-2-ylthiophene-2-carboxamide.
| Compound Name | N-[[4-(4-benzylpiperazin-1-yl)oxan-4-yl]methyl]-N-pyridin-2-ylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 139462043 |
| Molecular Formula | C27H32N4O2S |
| Molecular Weight | 476.65 g/mol |
| Exact Mass | 476.22 |
| IUPAC Name | N-[[4-(4-benzylpiperazin-1-yl)oxan-4-yl]methyl]-N-pyridin-2-ylthiophene-2-carboxamide |
| SMILES | O=C(c1cccs1)N(CC1(N2CCN(Cc3ccccc3)CC2)CCOCC1)c1ccccn1 |
| InChI | InChI=1S/C27H32N4O2S/c32-26(24-9-6-20-34-24)31(25-10-4-5-13-28-25)22-27(11-18-33-19-12-27)30-16-14-29(15-17-30)21-23-7-2-1-3-8-23/h1-10,13,20H,11-12,14-19,21-22H2 |
| InChIKey | URZQHMJSLRHILB-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 48.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.65 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |