C31H32N4O3 — CID 160519669
tert-butyl 3-[5-[4-(2-pyridin-2-ylacetyl)phenyl]quinazolin-8-yl]piperidine-1-carboxylate (PubChem CID 160519669) has the molecular formula C31H32N4O3 and a molecular weight of 508.62 g/mol. Its IUPAC name is tert-butyl 3-[5-[4-(2-pyridin-2-ylacetyl)phenyl]quinazolin-8-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[5-[4-(2-pyridin-2-ylacetyl)phenyl]quinazolin-8-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 160519669 |
| Molecular Formula | C31H32N4O3 |
| Molecular Weight | 508.62 g/mol |
| Exact Mass | 508.25 |
| IUPAC Name | tert-butyl 3-[5-[4-(2-pyridin-2-ylacetyl)phenyl]quinazolin-8-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(c2ccc(-c3ccc(C(=O)Cc4ccccn4)cc3)c3cncnc23)C1 |
| InChI | InChI=1S/C31H32N4O3/c1-31(2,3)38-30(37)35-16-6-7-23(19-35)26-14-13-25(27-18-32-20-34-29(26)27)21-9-11-22(12-10-21)28(36)17-24-8-4-5-15-33-24/h4-5,8-15,18,20,23H,6-7,16-17,19H2,1-3H3 |
| InChIKey | DARRIQLVLVCVAP-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 85.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.62 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |