C26H31Br2NO4 — CID 160524221
1-(5-bromo-2-cyclopentyloxyphenyl)ethanone;N-[1-(5-bromo-2-cyclopentyloxyphenyl)ethylidene]hydroxylamine (PubChem CID 160524221) has the molecular formula C26H31Br2NO4 and a molecular weight of 581.35 g/mol. Its IUPAC name is 1-(5-bromo-2-cyclopentyloxyphenyl)ethanone;N-[1-(5-bromo-2-cyclopentyloxyphenyl)ethylidene]hydroxylamine.
| Compound Name | 1-(5-bromo-2-cyclopentyloxyphenyl)ethanone;N-[1-(5-bromo-2-cyclopentyloxyphenyl)ethylidene]hydroxylamine |
|---|---|
| PubChem CID | 160524221 |
| Molecular Formula | C26H31Br2NO4 |
| Molecular Weight | 581.35 g/mol |
| Exact Mass | 579.06 |
| IUPAC Name | 1-(5-bromo-2-cyclopentyloxyphenyl)ethanone;N-[1-(5-bromo-2-cyclopentyloxyphenyl)ethylidene]hydroxylamine |
| SMILES | CC(=NO)c1cc(Br)ccc1OC1CCCC1.CC(=O)c1cc(Br)ccc1OC1CCCC1 |
| InChI | InChI=1S/C13H16BrNO2.C13H15BrO2/c1-9(15-16)12-8-10(14)6-7-13(12)17-11-4-2-3-5-11;1-9(15)12-8-10(14)6-7-13(12)16-11-4-2-3-5-11/h6-8,11,16H,2-5H2,1H3;6-8,11H,2-5H2,1H3 |
| InChIKey | QURHYKAQMLFRJM-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.35 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|