C24H32N8S2 — CID 160529095
7-methylsulfanyl-5-piperidin-3-ylpyrazolo[1,5-a]pyrimidine (PubChem CID 160529095) has the molecular formula C24H32N8S2 and a molecular weight of 496.71 g/mol. Its IUPAC name is 7-methylsulfanyl-5-piperidin-3-ylpyrazolo[1,5-a]pyrimidine.
| Compound Name | 7-methylsulfanyl-5-piperidin-3-ylpyrazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 160529095 |
| Molecular Formula | C24H32N8S2 |
| Molecular Weight | 496.71 g/mol |
| Exact Mass | 496.22 |
| IUPAC Name | 7-methylsulfanyl-5-piperidin-3-ylpyrazolo[1,5-a]pyrimidine |
| SMILES | CSc1cc(C2CCCNC2)nc2ccnn12.CSc1cc(C2CCCNC2)nc2ccnn12 |
| InChI | InChI=1S/2C12H16N4S/c2*1-17-12-7-10(9-3-2-5-13-8-9)15-11-4-6-14-16(11)12/h2*4,6-7,9,13H,2-3,5,8H2,1H3 |
| InChIKey | QVHJNNKFBKHRFF-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 84.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.71 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |