About 2-ethylpyrazine;2-propan-2-ylpyrazine;2-propylpyrazine
2-ethylpyrazine;2-propan-2-ylpyrazine;2-propylpyrazine (PubChem CID 160532833) has the molecular formula C20H28N6
and a molecular weight of 352.49 g/mol. Its IUPAC name is 2-ethylpyrazine;2-propan-2-ylpyrazine;2-propylpyrazine.
Molecular Properties
| Compound Name | 2-ethylpyrazine;2-propan-2-ylpyrazine;2-propylpyrazine |
| PubChem CID | 160532833 |
| Molecular Formula | C20H28N6 |
| Molecular Weight | 352.49 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | 2-ethylpyrazine;2-propan-2-ylpyrazine;2-propylpyrazine |
| SMILES | CC(C)c1cnccn1.CCCc1cnccn1.CCc1cnccn1 |
| InChI | InChI=1S/2C7H10N2.C6H8N2/c1-6(2)7-5-8-3-4-9-7;1-2-3-7-6-8-4-5-9-7;1-2-6-5-7-3-4-8-6/h3-6H,1-2H3;4-6H,2-3H2,1H3;3-5H,2H2,1H3 |
| InChIKey | QVTURGNCGYIZAE-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.49 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-ethylpyrazine;2-propan-2-ylpyrazine;2-propylpyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylpyrazine;2-propan-2-ylpyrazine;2-propylpyrazine?
The IUPAC name of 2-ethylpyrazine;2-propan-2-ylpyrazine;2-propylpyrazine (CID 160532833) is 2-ethylpyrazine;2-propan-2-ylpyrazine;2-propylpyrazine.
What is the SMILES notation for 2-ethylpyrazine;2-propan-2-ylpyrazine;2-propylpyrazine?
The canonical SMILES for 2-ethylpyrazine;2-propan-2-ylpyrazine;2-propylpyrazine is CC(C)c1cnccn1.CCCc1cnccn1.CCc1cnccn1.
What is the InChIKey of 2-ethylpyrazine;2-propan-2-ylpyrazine;2-propylpyrazine?
The InChIKey is QVTURGNCGYIZAE-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H10N2.C6H8N2/c1-6(2)7-5-8-3-4-9-7;1-2-3-7-6-8-4-5-9-7;1-2-6-5-7-3-4-8-6/h3-6H,1-2H3;4-6H,2-3H2,1H3;3-5H,2H2,1H3.
What are the key properties of 2-ethylpyrazine;2-propan-2-ylpyrazine;2-propylpyrazine?
2-ethylpyrazine;2-propan-2-ylpyrazine;2-propylpyrazine has a molecular weight of 352.49 g/mol, XLogP of 4.07, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylpyrazine;2-propan-2-ylpyrazine;2-propylpyrazine is sourced from PubChem (CID 160532833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).