About 2-butylpyrazine;fluoro dihydrogen phosphate
2-butylpyrazine;fluoro dihydrogen phosphate (PubChem CID 174913013) has the molecular formula C8H14FN2O4P
and a molecular weight of 252.18 g/mol. Its IUPAC name is 2-butylpyrazine;fluoro dihydrogen phosphate.
Molecular Properties
| Compound Name | 2-butylpyrazine;fluoro dihydrogen phosphate |
| PubChem CID | 174913013 |
| Molecular Formula | C8H14FN2O4P |
| Molecular Weight | 252.18 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | 2-butylpyrazine;fluoro dihydrogen phosphate |
| SMILES | CCCCc1cnccn1.O=P(O)(O)OF |
| InChI | InChI=1S/C8H12N2.FH2O4P/c1-2-3-4-8-7-9-5-6-10-8;1-5-6(2,3)4/h5-7H,2-4H2,1H3;(H2,2,3,4) |
| InChIKey | VTEGOMVPXCIMGR-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 92.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.18 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-butylpyrazine;fluoro dihydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butylpyrazine;fluoro dihydrogen phosphate?
The IUPAC name of 2-butylpyrazine;fluoro dihydrogen phosphate (CID 174913013) is 2-butylpyrazine;fluoro dihydrogen phosphate.
What is the SMILES notation for 2-butylpyrazine;fluoro dihydrogen phosphate?
The canonical SMILES for 2-butylpyrazine;fluoro dihydrogen phosphate is CCCCc1cnccn1.O=P(O)(O)OF.
What is the InChIKey of 2-butylpyrazine;fluoro dihydrogen phosphate?
The InChIKey is VTEGOMVPXCIMGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2.FH2O4P/c1-2-3-4-8-7-9-5-6-10-8;1-5-6(2,3)4/h5-7H,2-4H2,1H3;(H2,2,3,4).
What are the key properties of 2-butylpyrazine;fluoro dihydrogen phosphate?
2-butylpyrazine;fluoro dihydrogen phosphate has a molecular weight of 252.18 g/mol, XLogP of 1.80, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butylpyrazine;fluoro dihydrogen phosphate is sourced from PubChem (CID 174913013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).