C23H34N2O2 — CID 142686363
1-(2,3-dibutyl-4-methoxyphenyl)-4-pyrazin-2-ylbutan-1-ol (PubChem CID 142686363) has the molecular formula C23H34N2O2 and a molecular weight of 370.54 g/mol. Its IUPAC name is 1-(2,3-dibutyl-4-methoxyphenyl)-4-pyrazin-2-ylbutan-1-ol.
| Compound Name | 1-(2,3-dibutyl-4-methoxyphenyl)-4-pyrazin-2-ylbutan-1-ol |
|---|---|
| PubChem CID | 142686363 |
| Molecular Formula | C23H34N2O2 |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 370.26 |
| IUPAC Name | 1-(2,3-dibutyl-4-methoxyphenyl)-4-pyrazin-2-ylbutan-1-ol |
| SMILES | CCCCc1c(OC)ccc(C(O)CCCc2cnccn2)c1CCCC |
| InChI | InChI=1S/C23H34N2O2/c1-4-6-10-19-20(13-14-23(27-3)21(19)11-7-5-2)22(26)12-8-9-18-17-24-15-16-25-18/h13-17,22,26H,4-12H2,1-3H3 |
| InChIKey | VWCBYFMZMCCPPD-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |