About methane;1-methylpyrrole;1-propan-2-ylpyrrolidin-2-one
methane;1-methylpyrrole;1-propan-2-ylpyrrolidin-2-one (PubChem CID 160536510) has the molecular formula C14H28N2O
and a molecular weight of 240.39 g/mol. Its IUPAC name is methane;1-methylpyrrole;1-propan-2-ylpyrrolidin-2-one.
Molecular Properties
| Compound Name | methane;1-methylpyrrole;1-propan-2-ylpyrrolidin-2-one |
| PubChem CID | 160536510 |
| Molecular Formula | C14H28N2O |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.22 |
| IUPAC Name | methane;1-methylpyrrole;1-propan-2-ylpyrrolidin-2-one |
| SMILES | C.C.CC(C)N1CCCC1=O.Cn1cccc1 |
| InChI | InChI=1S/C7H13NO.C5H7N.2CH4/c1-6(2)8-5-3-4-7(8)9;1-6-4-2-3-5-6;;/h6H,3-5H2,1-2H3;2-5H,1H3;2*1H4 |
| InChIKey | QWFONJDOUSLEBA-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methane;1-methylpyrrole;1-propan-2-ylpyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;1-methylpyrrole;1-propan-2-ylpyrrolidin-2-one?
The IUPAC name of methane;1-methylpyrrole;1-propan-2-ylpyrrolidin-2-one (CID 160536510) is methane;1-methylpyrrole;1-propan-2-ylpyrrolidin-2-one.
What is the SMILES notation for methane;1-methylpyrrole;1-propan-2-ylpyrrolidin-2-one?
The canonical SMILES for methane;1-methylpyrrole;1-propan-2-ylpyrrolidin-2-one is C.C.CC(C)N1CCCC1=O.Cn1cccc1.
What is the InChIKey of methane;1-methylpyrrole;1-propan-2-ylpyrrolidin-2-one?
The InChIKey is QWFONJDOUSLEBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO.C5H7N.2CH4/c1-6(2)8-5-3-4-7(8)9;1-6-4-2-3-5-6;;/h6H,3-5H2,1-2H3;2-5H,1H3;2*1H4.
What are the key properties of methane;1-methylpyrrole;1-propan-2-ylpyrrolidin-2-one?
methane;1-methylpyrrole;1-propan-2-ylpyrrolidin-2-one has a molecular weight of 240.39 g/mol, XLogP of 3.31, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methane;1-methylpyrrole;1-propan-2-ylpyrrolidin-2-one is sourced from PubChem (CID 160536510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).