About 2-fluoro-3-hydroxybenzonitrile;2-iodopropane
2-fluoro-3-hydroxybenzonitrile;2-iodopropane (PubChem CID 160539344) has the molecular formula C10H11FINO
and a molecular weight of 307.11 g/mol. Its IUPAC name is 2-fluoro-3-hydroxybenzonitrile;2-iodopropane.
Molecular Properties
| Compound Name | 2-fluoro-3-hydroxybenzonitrile;2-iodopropane |
| PubChem CID | 160539344 |
| Molecular Formula | C10H11FINO |
| Molecular Weight | 307.11 g/mol |
| Exact Mass | 306.99 |
| IUPAC Name | 2-fluoro-3-hydroxybenzonitrile;2-iodopropane |
| SMILES | CC(C)I.N#Cc1cccc(O)c1F |
| InChI | InChI=1S/C7H4FNO.C3H7I/c8-7-5(4-9)2-1-3-6(7)10;1-3(2)4/h1-3,10H;3H,1-2H3 |
| InChIKey | QWONZMVQGLSYNH-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.11 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-3-hydroxybenzonitrile;2-iodopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-3-hydroxybenzonitrile;2-iodopropane?
The IUPAC name of 2-fluoro-3-hydroxybenzonitrile;2-iodopropane (CID 160539344) is 2-fluoro-3-hydroxybenzonitrile;2-iodopropane.
What is the SMILES notation for 2-fluoro-3-hydroxybenzonitrile;2-iodopropane?
The canonical SMILES for 2-fluoro-3-hydroxybenzonitrile;2-iodopropane is CC(C)I.N#Cc1cccc(O)c1F.
What is the InChIKey of 2-fluoro-3-hydroxybenzonitrile;2-iodopropane?
The InChIKey is QWONZMVQGLSYNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4FNO.C3H7I/c8-7-5(4-9)2-1-3-6(7)10;1-3(2)4/h1-3,10H;3H,1-2H3.
What are the key properties of 2-fluoro-3-hydroxybenzonitrile;2-iodopropane?
2-fluoro-3-hydroxybenzonitrile;2-iodopropane has a molecular weight of 307.11 g/mol, XLogP of 3.23, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-3-hydroxybenzonitrile;2-iodopropane is sourced from PubChem (CID 160539344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).