C13H12FN — CID 170352587
3-(3,3-dimethylbut-1-ynyl)-2-fluorobenzonitrile (PubChem CID 170352587) has the molecular formula C13H12FN and a molecular weight of 201.24 g/mol. Its IUPAC name is 3-(3,3-dimethylbut-1-ynyl)-2-fluorobenzonitrile.
| Compound Name | 3-(3,3-dimethylbut-1-ynyl)-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 170352587 |
| Molecular Formula | C13H12FN |
| Molecular Weight | 201.24 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | 3-(3,3-dimethylbut-1-ynyl)-2-fluorobenzonitrile |
| SMILES | CC(C)(C)C#Cc1cccc(C#N)c1F |
| InChI | InChI=1S/C13H12FN/c1-13(2,3)8-7-10-5-4-6-11(9-15)12(10)14/h4-6H,1-3H3 |
| InChIKey | KVLNVSBFUZBVFT-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.24 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|