C37H36F2N4O3 — CID 160540412
tert-butyl N-[(2S)-4-(2-fluoro-5-pyridin-4-ylphenyl)-3-oxo-1-phenylbutan-2-yl]carbamate;2-fluoro-5-pyridin-4-ylaniline (PubChem CID 160540412) has the molecular formula C37H36F2N4O3 and a molecular weight of 622.72 g/mol. Its IUPAC name is tert-butyl N-[(2S)-4-(2-fluoro-5-pyridin-4-ylphenyl)-3-oxo-1-phenylbutan-2-yl]carbamate;2-fluoro-5-pyridin-4-ylaniline.
| Compound Name | tert-butyl N-[(2S)-4-(2-fluoro-5-pyridin-4-ylphenyl)-3-oxo-1-phenylbutan-2-yl]carbamate;2-fluoro-5-pyridin-4-ylaniline |
|---|---|
| PubChem CID | 160540412 |
| Molecular Formula | C37H36F2N4O3 |
| Molecular Weight | 622.72 g/mol |
| Exact Mass | 622.28 |
| IUPAC Name | tert-butyl N-[(2S)-4-(2-fluoro-5-pyridin-4-ylphenyl)-3-oxo-1-phenylbutan-2-yl]carbamate;2-fluoro-5-pyridin-4-ylaniline |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1ccccc1)C(=O)Cc1cc(-c2ccncc2)ccc1F.Nc1cc(-c2ccncc2)ccc1F |
| InChI | InChI=1S/C26H27FN2O3.C11H9FN2/c1-26(2,3)32-25(31)29-23(15-18-7-5-4-6-8-18)24(30)17-21-16-20(9-10-22(21)27)19-11-13-28-14-12-19;12-10-2-1-9(7-11(10)13)8-3-5-14-6-4-8/h4-14,16,23H,15,17H2,1-3H3,(H,29,31);1-7H,13H2/t23-;/m0./s1 |
| InChIKey | QWSBPKOPUBSPTP-BQAIUKQQSA-N |
| XLogP | 7.61 |
| TPSA | 107.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.72 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|