C29H35N3O4 — CID 70865482
tert-butyl N-[(2S)-1-(2-butoxy-5-pyridin-4-ylanilino)-1-oxo-3-phenylpropan-2-yl]carbamate (PubChem CID 70865482) has the molecular formula C29H35N3O4 and a molecular weight of 489.62 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-(2-butoxy-5-pyridin-4-ylanilino)-1-oxo-3-phenylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-(2-butoxy-5-pyridin-4-ylanilino)-1-oxo-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 70865482 |
| Molecular Formula | C29H35N3O4 |
| Molecular Weight | 489.62 g/mol |
| Exact Mass | 489.26 |
| IUPAC Name | tert-butyl N-[(2S)-1-(2-butoxy-5-pyridin-4-ylanilino)-1-oxo-3-phenylpropan-2-yl]carbamate |
| SMILES | CCCCOc1ccc(-c2ccncc2)cc1NC(=O)[C@H](Cc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C29H35N3O4/c1-5-6-18-35-26-13-12-23(22-14-16-30-17-15-22)20-24(26)31-27(33)25(19-21-10-8-7-9-11-21)32-28(34)36-29(2,3)4/h7-17,20,25H,5-6,18-19H2,1-4H3,(H,31,33)(H,32,34)/t25-/m0/s1 |
| InChIKey | KKKSVZPFLLPYBO-VWLOTQADSA-N |
| XLogP | 6.00 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.62 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|