C33H39N7O3 — CID 160541103
N-[2-[2-(dimethylamino)ethyl-methylamino]-5-[[4-[4-(4-isocyanopiperidin-1-yl)benzoyl]pyrimidin-2-yl]methyl]-4-methoxyphenyl]prop-2-enamide (PubChem CID 160541103) has the molecular formula C33H39N7O3 and a molecular weight of 581.72 g/mol. Its IUPAC name is N-[2-[2-(dimethylamino)ethyl-methylamino]-5-[[4-[4-(4-isocyanopiperidin-1-yl)benzoyl]pyrimidin-2-yl]methyl]-4-methoxyphenyl]prop-2-enamide.
| Compound Name | N-[2-[2-(dimethylamino)ethyl-methylamino]-5-[[4-[4-(4-isocyanopiperidin-1-yl)benzoyl]pyrimidin-2-yl]methyl]-4-methoxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 160541103 |
| Molecular Formula | C33H39N7O3 |
| Molecular Weight | 581.72 g/mol |
| Exact Mass | 581.31 |
| IUPAC Name | N-[2-[2-(dimethylamino)ethyl-methylamino]-5-[[4-[4-(4-isocyanopiperidin-1-yl)benzoyl]pyrimidin-2-yl]methyl]-4-methoxyphenyl]prop-2-enamide |
| SMILES | [C-]#[N+]C1CCN(c2ccc(C(=O)c3ccnc(Cc4cc(NC(=O)C=C)c(N(C)CCN(C)C)cc4OC)n3)cc2)CC1 |
| InChI | InChI=1S/C33H39N7O3/c1-7-32(41)37-28-20-24(30(43-6)22-29(28)39(5)19-18-38(3)4)21-31-35-15-12-27(36-31)33(42)23-8-10-26(11-9-23)40-16-13-25(34-2)14-17-40/h7-12,15,20,22,25H,1,13-14,16-19,21H2,3-6H3,(H,37,41) |
| InChIKey | QWUIUVNUBWWLSL-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 95.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.72 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|