C9H16NPt+3 — CID 160543488
platinum(2+);trimethyl-(1-methylcyclopenta-2,4-dien-1-yl)azanium (PubChem CID 160543488) has the molecular formula C9H16NPt+3 and a molecular weight of 333.31 g/mol. Its IUPAC name is platinum(2+);trimethyl-(1-methylcyclopenta-2,4-dien-1-yl)azanium.
| Compound Name | platinum(2+);trimethyl-(1-methylcyclopenta-2,4-dien-1-yl)azanium |
|---|---|
| PubChem CID | 160543488 |
| Molecular Formula | C9H16NPt+3 |
| Molecular Weight | 333.31 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | platinum(2+);trimethyl-(1-methylcyclopenta-2,4-dien-1-yl)azanium |
| SMILES | CC1([N+](C)(C)C)C=CC=C1.[Pt+2] |
| InChI | InChI=1S/C9H16N.Pt/c1-9(10(2,3)4)7-5-6-8-9;/h5-8H,1-4H3;/q+1;+2 |
| InChIKey | QXCJGLBYOGHOBM-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.31 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|