C28H27F3N4O7S — CID 160550436
(2S,3S)-N-(4-acetyl-1,3-thiazol-2-yl)-2-[(4R)-4-(4-ethoxyphenyl)-2,5-dioxoimidazolidin-1-yl]-3-phenylbutanamide;2,2,2-trifluoroacetic acid (PubChem CID 160550436) has the molecular formula C28H27F3N4O7S and a molecular weight of 620.61 g/mol. Its IUPAC name is (2S,3S)-N-(4-acetyl-1,3-thiazol-2-yl)-2-[(4R)-4-(4-ethoxyphenyl)-2,5-dioxoimidazolidin-1-yl]-3-phenylbutanamide;2,2,2-trifluoroacetic acid.
| Compound Name | (2S,3S)-N-(4-acetyl-1,3-thiazol-2-yl)-2-[(4R)-4-(4-ethoxyphenyl)-2,5-dioxoimidazolidin-1-yl]-3-phenylbutanamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 160550436 |
| Molecular Formula | C28H27F3N4O7S |
| Molecular Weight | 620.61 g/mol |
| Exact Mass | 620.16 |
| IUPAC Name | (2S,3S)-N-(4-acetyl-1,3-thiazol-2-yl)-2-[(4R)-4-(4-ethoxyphenyl)-2,5-dioxoimidazolidin-1-yl]-3-phenylbutanamide;2,2,2-trifluoroacetic acid |
| SMILES | CCOc1ccc([C@H]2NC(=O)N([C@H](C(=O)Nc3nc(C(C)=O)cs3)[C@@H](C)c3ccccc3)C2=O)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C26H26N4O5S.C2HF3O2/c1-4-35-19-12-10-18(11-13-19)21-24(33)30(26(34)28-21)22(15(2)17-8-6-5-7-9-17)23(32)29-25-27-20(14-36-25)16(3)31;3-2(4,5)1(6)7/h5-15,21-22H,4H2,1-3H3,(H,28,34)(H,27,29,32);(H,6,7)/t15-,21+,22-;/m0./s1 |
| InChIKey | QXZLCHXYDBNFAZ-WUARMDOMSA-N |
| XLogP | 4.78 |
| TPSA | 155.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.61 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|