C27H25FIN3O4 — CID 68619985
(2S,3S)-2-[4-(4-ethoxyphenyl)-2,5-dioxoimidazolidin-1-yl]-N-(2-fluoro-4-iodophenyl)-3-phenylbutanamide (PubChem CID 68619985) has the molecular formula C27H25FIN3O4 and a molecular weight of 601.42 g/mol. Its IUPAC name is (2S,3S)-2-[4-(4-ethoxyphenyl)-2,5-dioxoimidazolidin-1-yl]-N-(2-fluoro-4-iodophenyl)-3-phenylbutanamide.
| Compound Name | (2S,3S)-2-[4-(4-ethoxyphenyl)-2,5-dioxoimidazolidin-1-yl]-N-(2-fluoro-4-iodophenyl)-3-phenylbutanamide |
|---|---|
| PubChem CID | 68619985 |
| Molecular Formula | C27H25FIN3O4 |
| Molecular Weight | 601.42 g/mol |
| Exact Mass | 601.09 |
| IUPAC Name | (2S,3S)-2-[4-(4-ethoxyphenyl)-2,5-dioxoimidazolidin-1-yl]-N-(2-fluoro-4-iodophenyl)-3-phenylbutanamide |
| SMILES | CCOc1ccc(C2NC(=O)N([C@H](C(=O)Nc3ccc(I)cc3F)[C@@H](C)c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C27H25FIN3O4/c1-3-36-20-12-9-18(10-13-20)23-26(34)32(27(35)31-23)24(16(2)17-7-5-4-6-8-17)25(33)30-22-14-11-19(29)15-21(22)28/h4-16,23-24H,3H2,1-2H3,(H,30,33)(H,31,35)/t16-,23?,24-/m0/s1 |
| InChIKey | IEBLSDHQZBSIRC-VHWFRIBGSA-N |
| XLogP | 5.23 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.42 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|