C32H34FN3O6 — CID 68620152
(2S,3S)-N-(4-cyclopropyl-2-fluorophenyl)-2-[4-[4-[2-(2-hydroxyethoxy)ethoxy]phenyl]-2,5-dioxoimidazolidin-1-yl]-3-phenylbutanamide (PubChem CID 68620152) has the molecular formula C32H34FN3O6 and a molecular weight of 575.64 g/mol. Its IUPAC name is (2S,3S)-N-(4-cyclopropyl-2-fluorophenyl)-2-[4-[4-[2-(2-hydroxyethoxy)ethoxy]phenyl]-2,5-dioxoimidazolidin-1-yl]-3-phenylbutanamide.
| Compound Name | (2S,3S)-N-(4-cyclopropyl-2-fluorophenyl)-2-[4-[4-[2-(2-hydroxyethoxy)ethoxy]phenyl]-2,5-dioxoimidazolidin-1-yl]-3-phenylbutanamide |
|---|---|
| PubChem CID | 68620152 |
| Molecular Formula | C32H34FN3O6 |
| Molecular Weight | 575.64 g/mol |
| Exact Mass | 575.24 |
| IUPAC Name | (2S,3S)-N-(4-cyclopropyl-2-fluorophenyl)-2-[4-[4-[2-(2-hydroxyethoxy)ethoxy]phenyl]-2,5-dioxoimidazolidin-1-yl]-3-phenylbutanamide |
| SMILES | C[C@@H](c1ccccc1)[C@@H](C(=O)Nc1ccc(C2CC2)cc1F)N1C(=O)NC(c2ccc(OCCOCCO)cc2)C1=O |
| InChI | InChI=1S/C32H34FN3O6/c1-20(21-5-3-2-4-6-21)29(30(38)34-27-14-11-24(19-26(27)33)22-7-8-22)36-31(39)28(35-32(36)40)23-9-12-25(13-10-23)42-18-17-41-16-15-37/h2-6,9-14,19-20,22,28-29,37H,7-8,15-18H2,1H3,(H,34,38)(H,35,40)/t20-,28?,29-/m0/s1 |
| InChIKey | OXRJYNHIFWFENQ-YMEISZJLSA-N |
| XLogP | 4.49 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.64 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|